About 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene
1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene (PubChem CID 59229332) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
| PubChem CID | 59229332 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
| SMILES | CCCCCCCCOC1C(CC)=CC=C(C)C1C |
| InChI | InChI=1S/C18H32O/c1-5-7-8-9-10-11-14-19-18-16(4)15(3)12-13-17(18)6-2/h12-13,16,18H,5-11,14H2,1-4H3 |
| InChIKey | CPZSNTYPPIVQAN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene?
The IUPAC name of 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene (CID 59229332) is 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene.
What is the SMILES notation for 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene?
The canonical SMILES for 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene is CCCCCCCCOC1C(CC)=CC=C(C)C1C.
What is the InChIKey of 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene?
The InChIKey is CPZSNTYPPIVQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O/c1-5-7-8-9-10-11-14-19-18-16(4)15(3)12-13-17(18)6-2/h12-13,16,18H,5-11,14H2,1-4H3.
What are the key properties of 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene?
1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene has a molecular weight of 264.45 g/mol, XLogP of 5.66, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,5-dimethyl-6-octoxycyclohexa-1,3-diene is sourced from PubChem (CID 59229332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).