About 6-hydroxy-2,6-dimethyloct-7-enoate
6-hydroxy-2,6-dimethyloct-7-enoate (PubChem CID 59229403) has the molecular formula C10H17O3-
and a molecular weight of 185.24 g/mol. Its IUPAC name is 6-hydroxy-2,6-dimethyloct-7-enoate.
Molecular Properties
| Compound Name | 6-hydroxy-2,6-dimethyloct-7-enoate |
| PubChem CID | 59229403 |
| Molecular Formula | C10H17O3- |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 6-hydroxy-2,6-dimethyloct-7-enoate |
| SMILES | C=CC(C)(O)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C10H18O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,8,13H,1,5-7H2,2-3H3,(H,11,12)/p-1 |
| InChIKey | KRHSUSNBQYIYPF-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2,6-dimethyloct-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,6-dimethyloct-7-enoate?
The IUPAC name of 6-hydroxy-2,6-dimethyloct-7-enoate (CID 59229403) is 6-hydroxy-2,6-dimethyloct-7-enoate.
What is the SMILES notation for 6-hydroxy-2,6-dimethyloct-7-enoate?
The canonical SMILES for 6-hydroxy-2,6-dimethyloct-7-enoate is C=CC(C)(O)CCCC(C)C(=O)[O-].
What is the InChIKey of 6-hydroxy-2,6-dimethyloct-7-enoate?
The InChIKey is KRHSUSNBQYIYPF-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,8,13H,1,5-7H2,2-3H3,(H,11,12)/p-1.
What are the key properties of 6-hydroxy-2,6-dimethyloct-7-enoate?
6-hydroxy-2,6-dimethyloct-7-enoate has a molecular weight of 185.24 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,6-dimethyloct-7-enoate is sourced from PubChem (CID 59229403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).