6-hydroxy-2,6-dimethyloct-7-enoic acid

C10H18O3 — CID 59229404

IUPAC6-hydroxy-2,6-dimethyloct-7-enoic acid
SMILESC=CC(C)(O)CCCC(C)C(=O)O
InChIInChI=1S/C10H18O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,8,13H,1,5-7H2,2-3H3,(H,11,12)
InChIKeyKRHSUSNBQYIYPF-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.81
Rot. Bonds6

About 6-hydroxy-2,6-dimethyloct-7-enoic acid

6-hydroxy-2,6-dimethyloct-7-enoic acid (PubChem CID 59229404) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-hydroxy-2,6-dimethyloct-7-enoic acid.

Molecular Properties

Compound Name6-hydroxy-2,6-dimethyloct-7-enoic acid
PubChem CID59229404
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Name6-hydroxy-2,6-dimethyloct-7-enoic acid
SMILESC=CC(C)(O)CCCC(C)C(=O)O
InChIInChI=1S/C10H18O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,8,13H,1,5-7H2,2-3H3,(H,11,12)
InChIKeyKRHSUSNBQYIYPF-UHFFFAOYSA-N
XLogP1.81
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-hydroxy-2,6-dimethyloct-7-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-hydroxy-2,6-dimethyloct-7-enoic acid?
The IUPAC name of 6-hydroxy-2,6-dimethyloct-7-enoic acid (CID 59229404) is 6-hydroxy-2,6-dimethyloct-7-enoic acid.
What is the SMILES notation for 6-hydroxy-2,6-dimethyloct-7-enoic acid?
The canonical SMILES for 6-hydroxy-2,6-dimethyloct-7-enoic acid is C=CC(C)(O)CCCC(C)C(=O)O.
What is the InChIKey of 6-hydroxy-2,6-dimethyloct-7-enoic acid?
The InChIKey is KRHSUSNBQYIYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,8,13H,1,5-7H2,2-3H3,(H,11,12).
What are the key properties of 6-hydroxy-2,6-dimethyloct-7-enoic acid?
6-hydroxy-2,6-dimethyloct-7-enoic acid has a molecular weight of 186.25 g/mol, XLogP of 1.81, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,6-dimethyloct-7-enoic acid is sourced from PubChem (CID 59229404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).