C36H63O3- — CID 59229457
(E)-16-(4,5-dimethyl-6-octoxycyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-5-enoate (PubChem CID 59229457) has the molecular formula C36H63O3- and a molecular weight of 543.90 g/mol. Its IUPAC name is (E)-16-(4,5-dimethyl-6-octoxycyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-5-enoate.
| Compound Name | (E)-16-(4,5-dimethyl-6-octoxycyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-5-enoate |
|---|---|
| PubChem CID | 59229457 |
| Molecular Formula | C36H63O3- |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.48 |
| IUPAC Name | (E)-16-(4,5-dimethyl-6-octoxycyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-5-enoate |
| SMILES | CCCCCCCCOC1C(CCC(C)CCCC(C)CCC/C(C)=C/CCC(C)C(=O)[O-])=CC=C(C)C1C |
| InChI | InChI=1S/C36H64O3/c1-8-9-10-11-12-13-27-39-35-33(7)31(5)24-26-34(35)25-23-30(4)20-15-19-28(2)17-14-18-29(3)21-16-22-32(6)36(37)38/h21,24,26,28,30,32-33,35H,8-20,22-23,25,27H2,1-7H3,(H,37,38)/p-1/b29-21+ |
| InChIKey | KWWILFGMEACZBI-XHLNEMQHSA-M |
| XLogP | 9.76 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|