C7H8N4O2S — CID 592296
N-carbamoyl-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 592296) has the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. Its IUPAC name is N-carbamoyl-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-carbamoyl-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 592296 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | N-carbamoyl-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | NC(=O)NC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C7H8N4O2S/c8-6(13)11-5(12)4-14-7-9-2-1-3-10-7/h1-3H,4H2,(H3,8,11,12,13) |
| InChIKey | NNBFMXUTERZYND-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |