C18H30FN3O — CID 59229878
N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methylpentane-1,5-diamine (PubChem CID 59229878) has the molecular formula C18H30FN3O and a molecular weight of 323.46 g/mol. Its IUPAC name is N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methylpentane-1,5-diamine.
| Compound Name | N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 59229878 |
| Molecular Formula | C18H30FN3O |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N'-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1F |
| InChI | InChI=1S/C18H30FN3O/c1-13(10-20)5-4-8-21-18-7-6-16(9-17(18)19)22-11-14(2)23-15(3)12-22/h6-7,9,13-15,21H,4-5,8,10-12,20H2,1-3H3/t13?,14-,15+ |
| InChIKey | SVHDLIQZHIYWRQ-GOOCMWNKSA-N |
| XLogP | 3.23 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|