C22H37N3O3S — CID 59230032
N-[4-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 59230032) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is N-[4-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230032 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[4-[[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2ccc(N3C[C@@H](C)O[C@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C22H37N3O3S/c1-16(2)29(26,27)24-21-7-5-19(6-8-21)13-23-20-9-11-22(12-10-20)25-14-17(3)28-18(4)15-25/h9-12,16-19,21,23-24H,5-8,13-15H2,1-4H3/t17-,18-,19?,21?/m1/s1 |
| InChIKey | OTEOLTSRTLQWAT-NQAMIAIDSA-N |
| XLogP | 3.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|