C18H25F3N2O4S — CID 59230048
2-methyl-N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 59230048) has the molecular formula C18H25F3N2O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-methyl-N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230048 |
| Molecular Formula | C18H25F3N2O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-methyl-N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(CNc2cc(F)c3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C18H25F3N2O4S/c1-17(2,3)28(24,25)23-12-6-4-11(5-7-12)10-22-13-8-14(19)16-15(9-13)26-18(20,21)27-16/h8-9,11-12,22-23H,4-7,10H2,1-3H3 |
| InChIKey | XOBGMNYOTIKVML-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|