About 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol
3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol (PubChem CID 592301) has the molecular formula C13H8Cl2N2O
and a molecular weight of 279.13 g/mol. Its IUPAC name is 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol.
Molecular Properties
| Compound Name | 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol |
| PubChem CID | 592301 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol |
| SMILES | OC1c2ccc(Cl)cc2N=Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H8Cl2N2O/c14-7-1-3-9-11(5-7)16-17-12-6-8(15)2-4-10(12)13(9)18/h1-6,13,18H |
| InChIKey | XQNFYVCXWLJISJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol?
The IUPAC name of 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol (CID 592301) is 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol.
What is the SMILES notation for 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol?
The canonical SMILES for 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol is OC1c2ccc(Cl)cc2N=Nc2cc(Cl)ccc21.
What is the InChIKey of 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol?
The InChIKey is XQNFYVCXWLJISJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O/c14-7-1-3-9-11(5-7)16-17-12-6-8(15)2-4-10(12)13(9)18/h1-6,13,18H.
What are the key properties of 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol?
3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol has a molecular weight of 279.13 g/mol, XLogP of 4.80, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dichloro-11H-benzo[c][1,2]benzodiazepin-11-ol is sourced from PubChem (CID 592301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).