C24H41N3O3S — CID 59230157
N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]pentane-2-sulfonamide (PubChem CID 59230157) has the molecular formula C24H41N3O3S and a molecular weight of 451.68 g/mol. Its IUPAC name is N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]pentane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]pentane-2-sulfonamide |
|---|---|
| PubChem CID | 59230157 |
| Molecular Formula | C24H41N3O3S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | N-[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]pentane-2-sulfonamide |
| SMILES | CCCC(C)S(=O)(=O)NC1CCC(CNc2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 |
| InChI | InChI=1S/C24H41N3O3S/c1-5-6-20(4)31(28,29)26-23-9-7-21(8-10-23)15-25-22-11-13-24(14-12-22)27-16-18(2)30-19(3)17-27/h11-14,18-21,23,25-26H,5-10,15-17H2,1-4H3/t18-,19+,20?,21?,23? |
| InChIKey | SVCOUDUQYNMYAY-VMSKMILBSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|