C20H32FN3O3S — CID 59230401
N-[4-[(3-fluoro-5-morpholin-4-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 59230401) has the molecular formula C20H32FN3O3S and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[4-[(3-fluoro-5-morpholin-4-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[(3-fluoro-5-morpholin-4-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230401 |
| Molecular Formula | C20H32FN3O3S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[4-[(3-fluoro-5-morpholin-4-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2cc(F)cc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C20H32FN3O3S/c1-15(2)28(25,26)23-18-5-3-16(4-6-18)14-22-19-11-17(21)12-20(13-19)24-7-9-27-10-8-24/h11-13,15-16,18,22-23H,3-10,14H2,1-2H3 |
| InChIKey | PDYABPVMZSCCQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |