C17H28FN3O — CID 59230766
N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]pentane-1,5-diamine (PubChem CID 59230766) has the molecular formula C17H28FN3O and a molecular weight of 309.43 g/mol. Its IUPAC name is N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]pentane-1,5-diamine.
| Compound Name | N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 59230766 |
| Molecular Formula | C17H28FN3O |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N'-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]pentane-1,5-diamine |
| SMILES | C[C@@H]1CN(c2cc(F)ccc2NCCCCCN)C[C@H](C)O1 |
| InChI | InChI=1S/C17H28FN3O/c1-13-11-21(12-14(2)22-13)17-10-15(18)6-7-16(17)20-9-5-3-4-8-19/h6-7,10,13-14,20H,3-5,8-9,11-12,19H2,1-2H3/t13-,14+ |
| InChIKey | SNZFDFIAWZCCGY-OKILXGFUSA-N |
| XLogP | 2.98 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|