C16H21F3N2O4S — CID 59231180
N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]ethanesulfonamide (PubChem CID 59231180) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]ethanesulfonamide.
| Compound Name | N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59231180 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[4-[[(2,2,7-trifluoro-1,3-benzodioxol-5-yl)amino]methyl]cyclohexyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCC(CNc2cc(F)c3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C16H21F3N2O4S/c1-2-26(22,23)21-11-5-3-10(4-6-11)9-20-12-7-13(17)15-14(8-12)24-16(18,19)25-15/h7-8,10-11,20-21H,2-6,9H2,1H3 |
| InChIKey | PLTIXWBPVYWFHD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|