C19H30FN3O — CID 59231302
N-[(4-aminocyclohexyl)methyl]-4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]aniline (PubChem CID 59231302) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]aniline.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]aniline |
|---|---|
| PubChem CID | 59231302 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]aniline |
| SMILES | C[C@H]1CN(c2ccc(NCC3CCC(N)CC3)cc2)C(F)[C@@H](C)O1 |
| InChI | InChI=1S/C19H30FN3O/c1-13-12-23(19(20)14(2)24-13)18-9-7-17(8-10-18)22-11-15-3-5-16(21)6-4-15/h7-10,13-16,19,22H,3-6,11-12,21H2,1-2H3/t13-,14+,15?,16?,19?/m0/s1 |
| InChIKey | AJIDZYYIIYPCEK-DEWGNNDJSA-N |
| XLogP | 3.53 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|