About N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine
N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine (PubChem CID 59231415) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine |
| PubChem CID | 59231415 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine |
| SMILES | NCCCCCNCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H22N2/c17-10-4-1-5-11-18-13-14-8-9-15-6-2-3-7-16(15)12-14/h2-3,6-9,12,18H,1,4-5,10-11,13,17H2 |
| InChIKey | UEAUVNMFCWSQFP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine?
The IUPAC name of N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine (CID 59231415) is N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine.
What is the SMILES notation for N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine?
The canonical SMILES for N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine is NCCCCCNCc1ccc2ccccc2c1.
What is the InChIKey of N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine?
The InChIKey is UEAUVNMFCWSQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c17-10-4-1-5-11-18-13-14-8-9-15-6-2-3-7-16(15)12-14/h2-3,6-9,12,18H,1,4-5,10-11,13,17H2.
What are the key properties of N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine?
N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine has a molecular weight of 242.37 g/mol, XLogP of 3.06, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(naphthalen-2-ylmethyl)pentane-1,5-diamine is sourced from PubChem (CID 59231415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).