C21H29N3O3S — CID 59231588
N-[[4-[[5-(3-methoxyphenyl)-2-pyridinyl]amino]cyclohexyl]methyl]ethanesulfonamide (PubChem CID 59231588) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[[4-[[5-(3-methoxyphenyl)-2-pyridinyl]amino]cyclohexyl]methyl]ethanesulfonamide.
| Compound Name | N-[[4-[[5-(3-methoxyphenyl)-2-pyridinyl]amino]cyclohexyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59231588 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[[4-[[5-(3-methoxyphenyl)-2-pyridinyl]amino]cyclohexyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1CCC(Nc2ccc(-c3cccc(OC)c3)cn2)CC1 |
| InChI | InChI=1S/C21H29N3O3S/c1-3-28(25,26)23-14-16-7-10-19(11-8-16)24-21-12-9-18(15-22-21)17-5-4-6-20(13-17)27-2/h4-6,9,12-13,15-16,19,23H,3,7-8,10-11,14H2,1-2H3,(H,22,24) |
| InChIKey | UQHWMRMSVRCCLS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |