About 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride
5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride (PubChem CID 59231692) has the molecular formula C15H13Cl3FN3O2
and a molecular weight of 392.65 g/mol. Its IUPAC name is 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride.
Molecular Properties
| Compound Name | 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride |
| PubChem CID | 59231692 |
| Molecular Formula | C15H13Cl3FN3O2 |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride |
| SMILES | CC(Oc1cc(C(=O)Cl)nnc1N(C)C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H13Cl3FN3O2/c1-7(12-8(16)4-5-9(19)13(12)17)24-11-6-10(14(18)23)20-21-15(11)22(2)3/h4-7H,1-3H3 |
| InChIKey | DIZSFSSTSCCWCJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride?
The IUPAC name of 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride (CID 59231692) is 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride.
What is the SMILES notation for 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride?
The canonical SMILES for 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride is CC(Oc1cc(C(=O)Cl)nnc1N(C)C)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride?
The InChIKey is DIZSFSSTSCCWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl3FN3O2/c1-7(12-8(16)4-5-9(19)13(12)17)24-11-6-10(14(18)23)20-21-15(11)22(2)3/h4-7H,1-3H3.
What are the key properties of 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride?
5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride has a molecular weight of 392.65 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-6-(dimethylamino)pyridazine-3-carbonyl chloride is sourced from PubChem (CID 59231692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).