About 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid (PubChem CID 59231711) has the molecular formula C19H14Cl2FN3O3
and a molecular weight of 422.24 g/mol. Its IUPAC name is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid |
| PubChem CID | 59231711 |
| Molecular Formula | C19H14Cl2FN3O3 |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid |
| SMILES | CC(Oc1cc(-c2ccc(C(=O)O)cc2)nnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H14Cl2FN3O3/c1-9(16-12(20)6-7-13(22)17(16)21)28-15-8-14(24-25-18(15)23)10-2-4-11(5-3-10)19(26)27/h2-9H,1H3,(H2,23,25)(H,26,27) |
| InChIKey | XIVRQRZGAMDTEH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid?
The IUPAC name of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid (CID 59231711) is 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid.
What is the SMILES notation for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid?
The canonical SMILES for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid is CC(Oc1cc(-c2ccc(C(=O)O)cc2)nnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid?
The InChIKey is XIVRQRZGAMDTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2FN3O3/c1-9(16-12(20)6-7-13(22)17(16)21)28-15-8-14(24-25-18(15)23)10-2-4-11(5-3-10)19(26)27/h2-9H,1H3,(H2,23,25)(H,26,27).
What are the key properties of 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid?
4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid has a molecular weight of 422.24 g/mol, XLogP of 5.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridazin-3-yl]benzoic acid is sourced from PubChem (CID 59231711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).