C14H21N3O9S3 — CID 59231718
3-nitrooxypropyl N-ethyl-N-(6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)carbamate (PubChem CID 59231718) has the molecular formula C14H21N3O9S3 and a molecular weight of 471.54 g/mol. Its IUPAC name is 3-nitrooxypropyl N-ethyl-N-(6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)carbamate.
| Compound Name | 3-nitrooxypropyl N-ethyl-N-(6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)carbamate |
|---|---|
| PubChem CID | 59231718 |
| Molecular Formula | C14H21N3O9S3 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 3-nitrooxypropyl N-ethyl-N-(6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl)carbamate |
| SMILES | CCN(C(=O)OCCCO[N+](=O)[O-])C1CC(C)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H21N3O9S3/c1-3-16(14(18)25-5-4-6-26-17(19)20)11-7-9(2)28(21,22)13-10(11)8-12(27-13)29(15,23)24/h8-9,11H,3-7H2,1-2H3,(H2,15,23,24) |
| InChIKey | WMNLMYBKRKWSIH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|