C18H21N3O8S3 — CID 59231732
[3-[ethyl-[(4S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 59231732) has the molecular formula C18H21N3O8S3 and a molecular weight of 503.58 g/mol. Its IUPAC name is [3-[ethyl-[(4S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [3-[ethyl-[(4S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 59231732 |
| Molecular Formula | C18H21N3O8S3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | [3-[ethyl-[(4S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | CCN(C(=O)c1cccc(CO[N+](=O)[O-])c1)[C@H]1CC(C)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C18H21N3O8S3/c1-3-20(17(22)13-6-4-5-12(8-13)10-29-21(23)24)15-7-11(2)31(25,26)18-14(15)9-16(30-18)32(19,27)28/h4-6,8-9,11,15H,3,7,10H2,1-2H3,(H2,19,27,28)/t11?,15-/m0/s1 |
| InChIKey | OCUVTMAJZFLPMG-MHTVFEQDSA-N |
| XLogP | 1.87 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|