C17H26N3O6S3+ — CID 59231755
[[(4S)-4-[ethyl(prop-2-enoxycarbonyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]methylidene-dimethylazanium (PubChem CID 59231755) has the molecular formula C17H26N3O6S3+ and a molecular weight of 464.61 g/mol. Its IUPAC name is [[(4S)-4-[ethyl(prop-2-enoxycarbonyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]methylidene-dimethylazanium.
| Compound Name | [[(4S)-4-[ethyl(prop-2-enoxycarbonyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 59231755 |
| Molecular Formula | C17H26N3O6S3+ |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [[(4S)-4-[ethyl(prop-2-enoxycarbonyl)amino]-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]methylidene-dimethylazanium |
| SMILES | C=CCOC(=O)N(CC)[C@H]1CC(C)S(=O)(=O)c2sc(S(=O)(=O)NC=[N+](C)C)cc21 |
| InChI | InChI=1S/C17H25N3O6S3/c1-6-8-26-17(21)20(7-2)14-9-12(3)28(22,23)16-13(14)10-15(27-16)29(24,25)18-11-19(4)5/h6,10-12,14H,1,7-9H2,2-5H3/p+1/t12?,14-/m0/s1 |
| InChIKey | OTYLUIQOVOMGOA-PYMCNQPYSA-O |
| XLogP | 1.58 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|