C18H20BF3N4O3 — CID 59231969
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 59231969) has the molecular formula C18H20BF3N4O3 and a molecular weight of 408.19 g/mol. Its IUPAC name is 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 59231969 |
| Molecular Formula | C18H20BF3N4O3 |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | CC1(C)OB(c2ccc(NC(=O)Nc3cc(C(F)(F)F)ccn3)nc2)OC1(C)C |
| InChI | InChI=1S/C18H20BF3N4O3/c1-16(2)17(3,4)29-19(28-16)12-5-6-13(24-10-12)25-15(27)26-14-9-11(7-8-23-14)18(20,21)22/h5-10H,1-4H3,(H2,23,24,25,26,27) |
| InChIKey | TXJIUHWJAOAVNW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|