C22H27BrN2O6S — CID 59232305
methyl 2-[2-bromo-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetate (PubChem CID 59232305) has the molecular formula C22H27BrN2O6S and a molecular weight of 527.44 g/mol. Its IUPAC name is methyl 2-[2-bromo-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 59232305 |
| Molecular Formula | C22H27BrN2O6S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | methyl 2-[2-bromo-5-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1cc(N2CCN(S(=O)(=O)c3ccc(OC(C)C)cc3)CC2)ccc1Br |
| InChI | InChI=1S/C22H27BrN2O6S/c1-16(2)31-18-5-7-19(8-6-18)32(27,28)25-12-10-24(11-13-25)17-4-9-20(23)21(14-17)30-15-22(26)29-3/h4-9,14,16H,10-13,15H2,1-3H3 |
| InChIKey | JVOOEUURHZKIET-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |