C22H19FN8O3S — CID 59233123
1-(2,3-dihydroxypropyl)-3-[6-[[6-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]imidazo[1,2-b]pyridazin-2-yl]urea (PubChem CID 59233123) has the molecular formula C22H19FN8O3S and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-[6-[[6-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]imidazo[1,2-b]pyridazin-2-yl]urea.
| Compound Name | 1-(2,3-dihydroxypropyl)-3-[6-[[6-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]imidazo[1,2-b]pyridazin-2-yl]urea |
|---|---|
| PubChem CID | 59233123 |
| Molecular Formula | C22H19FN8O3S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-[6-[[6-(3-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]imidazo[1,2-b]pyridazin-2-yl]urea |
| SMILES | O=C(NCC(O)CO)Nc1cn2nc(Sc3nnc4ccc(-c5cccc(F)c5)cn34)ccc2n1 |
| InChI | InChI=1S/C22H19FN8O3S/c23-15-3-1-2-13(8-15)14-4-5-19-27-28-22(30(19)10-14)35-20-7-6-18-25-17(11-31(18)29-20)26-21(34)24-9-16(33)12-32/h1-8,10-11,16,32-33H,9,12H2,(H2,24,26,34) |
| InChIKey | HAHDNVZPRZCLMZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |