C14H20NY- — CID 59233340
1,2,2,3,4-pentamethyl-4,6-dihydro-3H-quinolin-6-ide;yttrium (PubChem CID 59233340) has the molecular formula C14H20NY- and a molecular weight of 291.23 g/mol. Its IUPAC name is 1,2,2,3,4-pentamethyl-4,6-dihydro-3H-quinolin-6-ide;yttrium.
| Compound Name | 1,2,2,3,4-pentamethyl-4,6-dihydro-3H-quinolin-6-ide;yttrium |
|---|---|
| PubChem CID | 59233340 |
| Molecular Formula | C14H20NY- |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1,2,2,3,4-pentamethyl-4,6-dihydro-3H-quinolin-6-ide;yttrium |
| SMILES | CC1c2c[c-]ccc2N(C)C(C)(C)C1C.[Y] |
| InChI | InChI=1S/C14H20N.Y/c1-10-11(2)14(3,4)15(5)13-9-7-6-8-12(10)13;/h7-11H,1-5H3;/q-1; |
| InChIKey | MLVALECBDPAZRA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|