About 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one
1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one (PubChem CID 592338) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one.
Molecular Properties
| Compound Name | 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one |
| PubChem CID | 592338 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one |
| SMILES | CC1=CC(=O)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C10H17NO/c1-8-5-9(12)7-11(6-8)10(2,3)4/h5H,6-7H2,1-4H3 |
| InChIKey | KNERKISJHYBTQY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one?
The IUPAC name of 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one (CID 592338) is 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one.
What is the SMILES notation for 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one?
The canonical SMILES for 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one is CC1=CC(=O)CN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one?
The InChIKey is KNERKISJHYBTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-5-9(12)7-11(6-8)10(2,3)4/h5H,6-7H2,1-4H3.
What are the key properties of 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one?
1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one has a molecular weight of 167.25 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-methyl-2,6-dihydropyridin-3-one is sourced from PubChem (CID 592338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).