C12H10ClNO2 — CID 59233919
6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 59233919) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 59233919 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-chlorospiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1CC2(CCc3cc(Cl)ccc32)C(=O)N1 |
| InChI | InChI=1S/C12H10ClNO2/c13-8-1-2-9-7(5-8)3-4-12(9)6-10(15)14-11(12)16/h1-2,5H,3-4,6H2,(H,14,15,16) |
| InChIKey | FLRWSMYXJAPFJA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|