C19H22F6N2O4 — CID 59234865
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 59234865) has the molecular formula C19H22F6N2O4 and a molecular weight of 456.38 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234865 |
| Molecular Formula | C19H22F6N2O4 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(CCCCOc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C(=O)C1(C)C |
| InChI | InChI=1S/C19H22F6N2O4/c1-16(2)14(28)27(15(29)26(16)3)10-4-5-11-31-13-8-6-12(7-9-13)17(30,18(20,21)22)19(23,24)25/h6-9,30H,4-5,10-11H2,1-3H3 |
| InChIKey | ZYNVRYHLVBMXOA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|