C22H28F6N2O4 — CID 59235023
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-propan-2-ylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 59235023) has the molecular formula C22H28F6N2O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-propan-2-ylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-propan-2-ylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235023 |
| Molecular Formula | C22H28F6N2O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-propan-2-ylphenoxy]butyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CC(C)c1cc(OCCCCN2C(=O)N(C)C(C)(C)C2=O)ccc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H28F6N2O4/c1-13(2)15-12-14(8-9-16(15)20(33,21(23,24)25)22(26,27)28)34-11-7-6-10-30-17(31)19(3,4)29(5)18(30)32/h8-9,12-13,33H,6-7,10-11H2,1-5H3 |
| InChIKey | WUNXOAZLHDEQRN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|