C28H30F6N2O6 — CID 59235054
5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]imidazolidine-2,4-dione (PubChem CID 59235054) has the molecular formula C28H30F6N2O6 and a molecular weight of 604.54 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235054 |
| Molecular Formula | C28H30F6N2O6 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(CC)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C28H30F6N2O6/c1-3-7-17-14-19(26(39,27(29,30)31)28(32,33)34)9-10-20(17)40-13-6-5-12-36-23(37)25(4-2,35-24(36)38)18-8-11-21-22(15-18)42-16-41-21/h8-11,14-15,39H,3-7,12-13,16H2,1-2H3,(H,35,38) |
| InChIKey | ANGMNRLPRMARHS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|