C31H38F6N2O5 — CID 59235082
5-(4-ethoxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59235082) has the molecular formula C31H38F6N2O5 and a molecular weight of 632.64 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-ethoxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235082 |
| Molecular Formula | C31H38F6N2O5 |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 5-(4-ethoxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)NC(C)(c2ccc(OCC)cc2)C1=O |
| InChI | InChI=1S/C31H38F6N2O5/c1-5-10-20-18-23(29(42,30(32,33)34)31(35,36)37)19-21(11-6-2)25(20)44-17-9-8-16-39-26(40)28(4,38-27(39)41)22-12-14-24(15-13-22)43-7-3/h12-15,18-19,42H,5-11,16-17H2,1-4H3,(H,38,41) |
| InChIKey | IAUYPBWLYMUNHS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|