C30H34F6N2O6 — CID 59235130
5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59235130) has the molecular formula C30H34F6N2O6 and a molecular weight of 632.60 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235130 |
| Molecular Formula | C30H34F6N2O6 |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C30H34F6N2O6/c1-4-8-18-14-21(28(41,29(31,32)33)30(34,35)36)15-19(9-5-2)24(18)42-13-7-6-12-38-25(39)27(3,37-26(38)40)20-10-11-22-23(16-20)44-17-43-22/h10-11,14-16,41H,4-9,12-13,17H2,1-3H3,(H,37,40) |
| InChIKey | VWGTWONEZRKZRQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|