C27H29F6NO4 — CID 59235174
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-phenylpyrrolidine-2,4-dione (PubChem CID 59235174) has the molecular formula C27H29F6NO4 and a molecular weight of 545.52 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-phenylpyrrolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-phenylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 59235174 |
| Molecular Formula | C27H29F6NO4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-phenylpyrrolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCC1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H29F6NO4/c1-3-9-17-16-19(25(37,26(28,29)30)27(31,32)33)13-14-21(17)38-15-8-7-12-20-22(35)24(2,34-23(20)36)18-10-5-4-6-11-18/h4-6,10-11,13-14,16,20,37H,3,7-9,12,15H2,1-2H3,(H,34,36) |
| InChIKey | DVFCZDDEMZRACA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|