C41H32N4 — CID 59235716
N-methyl-4-[4-[4-(N-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)pyrimidin-2-amine (PubChem CID 59235716) has the molecular formula C41H32N4 and a molecular weight of 580.74 g/mol. Its IUPAC name is N-methyl-4-[4-[4-(N-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)pyrimidin-2-amine.
| Compound Name | N-methyl-4-[4-[4-(N-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59235716 |
| Molecular Formula | C41H32N4 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | N-methyl-4-[4-[4-(N-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)pyrimidin-2-amine |
| SMILES | CN(c1ccc(-c2ccccc2)cc1)c1nccc(-c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C41H32N4/c1-44(36-25-21-33(22-26-36)31-11-5-2-6-12-31)41-42-30-29-40(43-41)35-19-17-32(18-20-35)34-23-27-39(28-24-34)45(37-13-7-3-8-14-37)38-15-9-4-10-16-38/h2-30H,1H3 |
| InChIKey | XARDXCYQYYGVQO-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |