About 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione
8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione (PubChem CID 59235909) has the molecular formula C14H7ClN2O6
and a molecular weight of 334.67 g/mol. Its IUPAC name is 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione.
Molecular Properties
| Compound Name | 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione |
| PubChem CID | 59235909 |
| Molecular Formula | C14H7ClN2O6 |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(O)c(Cl)cc([N+](=O)[O-])c1C2=O |
| InChI | InChI=1S/C14H7ClN2O6/c15-4-3-6(17(22)23)9-11(12(4)19)13(20)8-5(16)1-2-7(18)10(8)14(9)21/h1-3,18-19H,16H2 |
| InChIKey | ZCBPVPXYSKLPIW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione?
The IUPAC name of 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione (CID 59235909) is 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione.
What is the SMILES notation for 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione?
The canonical SMILES for 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione is Nc1ccc(O)c2c1C(=O)c1c(O)c(Cl)cc([N+](=O)[O-])c1C2=O.
What is the InChIKey of 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione?
The InChIKey is ZCBPVPXYSKLPIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7ClN2O6/c15-4-3-6(17(22)23)9-11(12(4)19)13(20)8-5(16)1-2-7(18)10(8)14(9)21/h1-3,18-19H,16H2.
What are the key properties of 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione?
8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione has a molecular weight of 334.67 g/mol, XLogP of 2.02, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2-chloro-1,5-dihydroxy-4-nitroanthracene-9,10-dione is sourced from PubChem (CID 59235909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).