C22H14N2O3 — CID 59235910
6-(methylamino)-13H-naphtho[2,3-c]acridine-5,8,14-trione (PubChem CID 59235910) has the molecular formula C22H14N2O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 6-(methylamino)-13H-naphtho[2,3-c]acridine-5,8,14-trione.
| Compound Name | 6-(methylamino)-13H-naphtho[2,3-c]acridine-5,8,14-trione |
|---|---|
| PubChem CID | 59235910 |
| Molecular Formula | C22H14N2O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-(methylamino)-13H-naphtho[2,3-c]acridine-5,8,14-trione |
| SMILES | CNc1cc2c(=O)c3ccccc3[nH]c2c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H14N2O3/c1-23-16-10-14-19(24-15-9-5-4-8-13(15)20(14)25)18-17(16)21(26)11-6-2-3-7-12(11)22(18)27/h2-10,23H,1H3,(H,24,25) |
| InChIKey | KWXAXOHXXPVKEL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|