C69H53N — CID 59236111
3-[4-[(E)-2-[4-[9,9-dimethyl-7-(7,9,9-trimethylfluoren-2-yl)fluoren-2-yl]phenyl]-1-phenylethenyl]phenyl]-9-phenylcarbazole (PubChem CID 59236111) has the molecular formula C69H53N and a molecular weight of 896.19 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-[9,9-dimethyl-7-(7,9,9-trimethylfluoren-2-yl)fluoren-2-yl]phenyl]-1-phenylethenyl]phenyl]-9-phenylcarbazole.
| Compound Name | 3-[4-[(E)-2-[4-[9,9-dimethyl-7-(7,9,9-trimethylfluoren-2-yl)fluoren-2-yl]phenyl]-1-phenylethenyl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 59236111 |
| Molecular Formula | C69H53N |
| Molecular Weight | 896.19 g/mol |
| Exact Mass | 895.42 |
| IUPAC Name | 3-[4-[(E)-2-[4-[9,9-dimethyl-7-(7,9,9-trimethylfluoren-2-yl)fluoren-2-yl]phenyl]-1-phenylethenyl]phenyl]-9-phenylcarbazole |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc(/C=C(\c6ccccc6)c6ccc(-c7ccc8c(c7)c7ccccc7n8-c7ccccc7)cc6)cc5)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C69H53N/c1-44-20-33-55-56-35-30-52(42-64(56)68(2,3)62(55)38-44)53-31-36-58-57-34-29-51(41-63(57)69(4,5)65(58)43-53)46-23-21-45(22-24-46)39-60(48-14-8-6-9-15-48)49-27-25-47(26-28-49)50-32-37-67-61(40-50)59-18-12-13-19-66(59)70(67)54-16-10-7-11-17-54/h6-43H,1-5H3/b60-39+ |
| InChIKey | SFQYGICHUNGOSZ-HIJXTXFJSA-N |
| XLogP | 18.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.19 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|