C23H11F23O7 — CID 59236827
[2,2-bis(3,3-difluoroprop-2-enoyloxymethyl)-3-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxypropyl] 3,3-difluoroprop-2-enoate (PubChem CID 59236827) has the molecular formula C23H11F23O7 and a molecular weight of 836.29 g/mol. Its IUPAC name is [2,2-bis(3,3-difluoroprop-2-enoyloxymethyl)-3-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxypropyl] 3,3-difluoroprop-2-enoate.
| Compound Name | [2,2-bis(3,3-difluoroprop-2-enoyloxymethyl)-3-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxypropyl] 3,3-difluoroprop-2-enoate |
|---|---|
| PubChem CID | 59236827 |
| Molecular Formula | C23H11F23O7 |
| Molecular Weight | 836.29 g/mol |
| Exact Mass | 836.01 |
| IUPAC Name | [2,2-bis(3,3-difluoroprop-2-enoyloxymethyl)-3-[1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)pent-2-en-2-yl]oxypropyl] 3,3-difluoroprop-2-enoate |
| SMILES | O=C(C=C(F)F)OCC(COC(=O)C=C(F)F)(COC(=O)C=C(F)F)COC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H11F23O7/c24-8(25)1-11(47)50-4-16(5-51-12(48)2-9(26)27,6-52-13(49)3-10(28)29)7-53-15(19(32,33)34)14(17(30,20(35,36)37)21(38,39)40)18(31,22(41,42)43)23(44,45)46/h1-3H,4-7H2 |
| InChIKey | MVAWGASTRJGPLL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.29 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|