About 2-phenoxyethyl octanoate
2-phenoxyethyl octanoate (PubChem CID 59236950) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-phenoxyethyl octanoate.
Molecular Properties
| Compound Name | 2-phenoxyethyl octanoate |
| PubChem CID | 59236950 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-phenoxyethyl octanoate |
| SMILES | CCCCCCCC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C16H24O3/c1-2-3-4-5-9-12-16(17)19-14-13-18-15-10-7-6-8-11-15/h6-8,10-11H,2-5,9,12-14H2,1H3 |
| InChIKey | FTLLYZOWBWEERE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl octanoate?
The IUPAC name of 2-phenoxyethyl octanoate (CID 59236950) is 2-phenoxyethyl octanoate.
What is the SMILES notation for 2-phenoxyethyl octanoate?
The canonical SMILES for 2-phenoxyethyl octanoate is CCCCCCCC(=O)OCCOc1ccccc1.
What is the InChIKey of 2-phenoxyethyl octanoate?
The InChIKey is FTLLYZOWBWEERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-2-3-4-5-9-12-16(17)19-14-13-18-15-10-7-6-8-11-15/h6-8,10-11H,2-5,9,12-14H2,1H3.
What are the key properties of 2-phenoxyethyl octanoate?
2-phenoxyethyl octanoate has a molecular weight of 264.36 g/mol, XLogP of 3.97, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl octanoate is sourced from PubChem (CID 59236950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).