C16H13N7O9S4 — CID 59237640
1-[[4,6-diamino-2-(cyanomethylsulfanyl)pyrimidin-5-yl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid (PubChem CID 59237640) has the molecular formula C16H13N7O9S4 and a molecular weight of 575.59 g/mol. Its IUPAC name is 1-[[4,6-diamino-2-(cyanomethylsulfanyl)pyrimidin-5-yl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid.
| Compound Name | 1-[[4,6-diamino-2-(cyanomethylsulfanyl)pyrimidin-5-yl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 59237640 |
| Molecular Formula | C16H13N7O9S4 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 574.97 |
| IUPAC Name | 1-[[4,6-diamino-2-(cyanomethylsulfanyl)pyrimidin-5-yl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid |
| SMILES | N#CCSc1nc(N)c(/N=N/c2c(S(=O)(=O)O)ccc3c(SOOO)cc(S(=O)(=O)O)cc23)c(N)n1 |
| InChI | InChI=1S/C16H13N7O9S4/c17-3-4-33-16-20-14(18)13(15(19)21-16)23-22-12-9-5-7(35(25,26)27)6-10(34-32-31-24)8(9)1-2-11(12)36(28,29)30/h1-2,5-6,24H,4H2,(H,25,26,27)(H,28,29,30)(H4,18,19,20,21)/b23-22+ |
| InChIKey | RAQNZTCRATXNAA-GHVJWSGMSA-N |
| XLogP | 2.75 |
| TPSA | 273.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|