C7H8O6 — CID 59237686
but-3-ene-1,1,1-tricarboxylic acid (PubChem CID 59237686) has the molecular formula C7H8O6 and a molecular weight of 188.13 g/mol. Its IUPAC name is but-3-ene-1,1,1-tricarboxylic acid.
| Compound Name | but-3-ene-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 59237686 |
| Molecular Formula | C7H8O6 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | but-3-ene-1,1,1-tricarboxylic acid |
| SMILES | C=CCC(C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8O6/c1-2-3-7(4(8)9,5(10)11)6(12)13/h2H,1,3H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | RLWDEGPUUMFQMQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|