About CID 59237758
CID 59237758 (PubChem CID 59237758) has the molecular formula C6H4B2N4
and a molecular weight of 153.75 g/mol.
Molecular Properties
| Compound Name | CID 59237758 |
| PubChem CID | 59237758 |
| Molecular Formula | C6H4B2N4 |
| Molecular Weight | 153.75 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | — |
| SMILES | [B]n1ccnc1-c1nccn1[B] |
| InChI | InChI=1S/C6H4B2N4/c7-11-3-1-9-5(11)6-10-2-4-12(6)8/h1-4H |
| InChIKey | VTTZAKWLDOHKPM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.75 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59237758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59237758?
The IUPAC name of CID 59237758 (CID 59237758) is not available.
What is the SMILES notation for CID 59237758?
The canonical SMILES for CID 59237758 is [B]n1ccnc1-c1nccn1[B].
What is the InChIKey of CID 59237758?
The InChIKey is VTTZAKWLDOHKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4B2N4/c7-11-3-1-9-5(11)6-10-2-4-12(6)8/h1-4H.
What are the key properties of CID 59237758?
CID 59237758 has a molecular weight of 153.75 g/mol, XLogP of -0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59237758 is sourced from PubChem (CID 59237758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).