C34H48N4O4P+ — CID 59237963
3-[6-[2-[1-(3-diethoxyphosphorylpropyl)quinolin-1-ium-4-yl]ethenyl]-3,4-dihydro-2H-quinolin-1-yl]-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 59237963) has the molecular formula C34H48N4O4P+ and a molecular weight of 607.76 g/mol. Its IUPAC name is 3-[6-[2-[1-(3-diethoxyphosphorylpropyl)quinolin-1-ium-4-yl]ethenyl]-3,4-dihydro-2H-quinolin-1-yl]-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | 3-[6-[2-[1-(3-diethoxyphosphorylpropyl)quinolin-1-ium-4-yl]ethenyl]-3,4-dihydro-2H-quinolin-1-yl]-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 59237963 |
| Molecular Formula | C34H48N4O4P+ |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | 3-[6-[2-[1-(3-diethoxyphosphorylpropyl)quinolin-1-ium-4-yl]ethenyl]-3,4-dihydro-2H-quinolin-1-yl]-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | CCOP(=O)(CCC[n+]1ccc(C=Cc2ccc3c(c2)CCCN3CCC(=O)NCCN(C)C)c2ccccc21)OCC |
| InChI | InChI=1S/C34H47N4O4P/c1-5-41-43(40,42-6-2)26-10-22-38-23-18-29(31-12-7-8-13-33(31)38)16-14-28-15-17-32-30(27-28)11-9-21-37(32)24-19-34(39)35-20-25-36(3)4/h7-8,12-18,23,27H,5-6,9-11,19-22,24-26H2,1-4H3/p+1 |
| InChIKey | GORUPWRISACQLW-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|