C30H55F3O3Si2 — CID 59238363
(1R,7aR)-7a-methyl-1-[(Z,6R)-1,1,1-trifluoro-2,6,10-trimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59238363) has the molecular formula C30H55F3O3Si2 and a molecular weight of 576.93 g/mol. Its IUPAC name is (1R,7aR)-7a-methyl-1-[(Z,6R)-1,1,1-trifluoro-2,6,10-trimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-7a-methyl-1-[(Z,6R)-1,1,1-trifluoro-2,6,10-trimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59238363 |
| Molecular Formula | C30H55F3O3Si2 |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | (1R,7aR)-7a-methyl-1-[(Z,6R)-1,1,1-trifluoro-2,6,10-trimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(CCC[C@](C)(C/C=C\C(C)(O[Si](C)(C)C)C(F)(F)F)[C@H]1CCC2C(=O)CCC[C@@]21C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H55F3O3Si2/c1-26(2,35-37(6,7)8)18-13-19-27(3,25-17-16-23-24(34)15-12-21-28(23,25)4)20-14-22-29(5,30(31,32)33)36-38(9,10)11/h14,22-23,25H,12-13,15-21H2,1-11H3/b22-14-/t23?,25-,27-,28+,29?/m1/s1 |
| InChIKey | OZRZOFDOFXQNGD-CFPGFWBHSA-N |
| XLogP | 9.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|