About 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one
2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 59238505) has the molecular formula C13H10N2OS
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
| PubChem CID | 59238505 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | Cc1ccc(-c2nc3cc[nH]c(=O)c3s2)cc1 |
| InChI | InChI=1S/C13H10N2OS/c1-8-2-4-9(5-3-8)13-15-10-6-7-14-12(16)11(10)17-13/h2-7H,1H3,(H,14,16) |
| InChIKey | SHRWLARZOAIKGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one?
The IUPAC name of 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one (CID 59238505) is 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one.
What is the SMILES notation for 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one?
The canonical SMILES for 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one is Cc1ccc(-c2nc3cc[nH]c(=O)c3s2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one?
The InChIKey is SHRWLARZOAIKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2OS/c1-8-2-4-9(5-3-8)13-15-10-6-7-14-12(16)11(10)17-13/h2-7H,1H3,(H,14,16).
What are the key properties of 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one?
2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one has a molecular weight of 242.30 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-5H-[1,3]thiazolo[5,4-c]pyridin-4-one is sourced from PubChem (CID 59238505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).