About Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl-
Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- (PubChem CID 5923856) has the molecular formula C20H20NO2+
and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-methylquinolin-1-ium.
Molecular Properties
| Compound Name | Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- |
| PubChem CID | 5923856 |
| Molecular Formula | C20H20NO2+ |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-methylquinolin-1-ium |
| SMILES | C[N+]1=C(C=CC2=CC=CC=C21)/C=C/C3=CC(=C(C=C3)OC)OC |
| InChI | InChI=1S/C20H20NO2/c1-21-17(12-10-16-6-4-5-7-18(16)21)11-8-15-9-13-19(22-2)20(14-15)23-3/h4-14H,1-3H3/q+1/b11-8+ |
| InChIKey | IZIPTBVOQVGYLK-DHZHZOJOSA-N |
| XLogP | 4.60 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 397 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl-?
The IUPAC name of Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- (CID 5923856) is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-methylquinolin-1-ium.
What is the SMILES notation for Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl-?
The canonical SMILES for Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- is C[N+]1=C(C=CC2=CC=CC=C21)/C=C/C3=CC(=C(C=C3)OC)OC.
What is the InChIKey of Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl-?
The InChIKey is IZIPTBVOQVGYLK-DHZHZOJOSA-N. The full InChI is InChI=1S/C20H20NO2/c1-21-17(12-10-16-6-4-5-7-18(16)21)11-8-15-9-13-19(22-2)20(14-15)23-3/h4-14H,1-3H3/q+1/b11-8+.
What are the key properties of Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl-?
Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- has a molecular weight of 306.40 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Quinolinium, 2-(3,4-dimethoxystyryl)-1-methyl- is sourced from PubChem (CID 5923856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).