C15H25BO2 — CID 59238853
2-(7,7-dimethyl-2-bicyclo[4.1.0]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59238853) has the molecular formula C15H25BO2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 2-(7,7-dimethyl-2-bicyclo[4.1.0]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(7,7-dimethyl-2-bicyclo[4.1.0]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59238853 |
| Molecular Formula | C15H25BO2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-(7,7-dimethyl-2-bicyclo[4.1.0]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)C2CCC=C(B3OC(C)(C)C(C)(C)O3)C21 |
| InChI | InChI=1S/C15H25BO2/c1-13(2)10-8-7-9-11(12(10)13)16-17-14(3,4)15(5,6)18-16/h9-10,12H,7-8H2,1-6H3 |
| InChIKey | XJMAXOXCNGOCEF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|