C43H36N4O4S — CID 59238856
1-(benzenesulfonyl)-5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine (PubChem CID 59238856) has the molecular formula C43H36N4O4S and a molecular weight of 704.85 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59238856 |
| Molecular Formula | C43H36N4O4S |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2cnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)c2cc(C3=CCC4(CC3)OCCO4)cnc21 |
| InChI | InChI=1S/C43H36N4O4S/c48-52(49,38-19-11-4-12-20-38)46-31-40(39-27-33(28-44-41(39)46)32-21-23-42(24-22-32)50-25-26-51-42)34-29-45-47(30-34)43(35-13-5-1-6-14-35,36-15-7-2-8-16-36)37-17-9-3-10-18-37/h1-21,27-31H,22-26H2 |
| InChIKey | XOSCGPUHXFYUSV-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|