C26H25Br2N3O2 — CID 59238876
4-[4-[(2,10-dibromo-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]butyl]morpholine (PubChem CID 59238876) has the molecular formula C26H25Br2N3O2 and a molecular weight of 571.31 g/mol. Its IUPAC name is 4-[4-[(2,10-dibromo-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]butyl]morpholine.
| Compound Name | 4-[4-[(2,10-dibromo-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]butyl]morpholine |
|---|---|
| PubChem CID | 59238876 |
| Molecular Formula | C26H25Br2N3O2 |
| Molecular Weight | 571.31 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 4-[4-[(2,10-dibromo-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]butyl]morpholine |
| SMILES | Brc1ccc2[nH]c3c(OCCCCN4CCOCC4)c4[nH]c5ccc(Br)cc5c4cc3c2c1 |
| InChI | InChI=1S/C26H25Br2N3O2/c27-16-3-5-22-18(13-16)20-15-21-19-14-17(28)4-6-23(19)30-25(21)26(24(20)29-22)33-10-2-1-7-31-8-11-32-12-9-31/h3-6,13-15,29-30H,1-2,7-12H2 |
| InChIKey | YWIXAONBATTWLC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.31 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|