C21H14F5N3O3S — CID 59238916
N-[2-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 59238916) has the molecular formula C21H14F5N3O3S and a molecular weight of 483.42 g/mol. Its IUPAC name is N-[2-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 59238916 |
| Molecular Formula | C21H14F5N3O3S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-[2-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCCOc1c2[nH]c3ccc(F)cc3c2cc2c1[nH]c1ccc(F)cc12)C(F)(F)F |
| InChI | InChI=1S/C21H14F5N3O3S/c22-10-1-3-16-12(7-10)14-9-15-13-8-11(23)2-4-17(13)29-19(15)20(18(14)28-16)32-6-5-27-33(30,31)21(24,25)26/h1-4,7-9,27-29H,5-6H2 |
| InChIKey | DRUMRUKJKDNPEJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|